From adafda90ca6bca3cead1538a96079545c621edc2 Mon Sep 17 00:00:00 2001 From: Simon van Hemert <simon.vanhemert@hslu.ch> Date: Fri, 13 Nov 2020 11:06:00 +0000 Subject: [PATCH] 1st --- data/Block 0/Daten_Serie_1.zip | Bin 0 -> 6591 bytes .../Checking_Correct_Installation.ipynb | 131 ++ .../Exercise Sheet - Basics Numpy.ipynb | 473 ++++++ .../Block 0/Solution - Basics Numpy.ipynb | 1507 +++++++++++++++++ requirements.txt | 5 + 5 files changed, 2116 insertions(+) create mode 100644 data/Block 0/Daten_Serie_1.zip create mode 100644 notebooks/Block 0/Checking_Correct_Installation.ipynb create mode 100644 notebooks/Block 0/Exercise Sheet - Basics Numpy.ipynb create mode 100644 notebooks/Block 0/Solution - Basics Numpy.ipynb diff --git a/data/Block 0/Daten_Serie_1.zip b/data/Block 0/Daten_Serie_1.zip new file mode 100644 index 0000000000000000000000000000000000000000..39f181fd828efc6a053309c4085dd77789304f85 GIT binary patch literal 6591 zcmcJT2RzjOAIEXzF6*r9IIAvuRElu+PF82+>}*+?3FSy+C9<NQtnB<`Z<3jmove_R zh$G7XE`PeC`u`q}|Ks<)#~F{i&-43UpZELq{b;HJ2#?}nuAW<hmwx>5-yh_7U_3cf zH%mu^wxx@WB|=C*7fy=D>EnjD12IFa;nU!0qSw;k0nsl9x63NnYv~THHMh30x8OH- zy^ev9q9MmW<ijx#hs#%7hg&IqX9}*3GXxC{4t6VUEvWL(xEdA3<V=xqJ5#C9WcjDN zRUmG@dluQHdxx(WXi_vh+}kTM?0y5a?riWP(MGIeCb-vY`+5@6Yw*$135l)o>ypR& zZ0eK8$K4Eq4M(IV>w_EJrHrS0g^vfLdK=G64bi4-v-B?Z_x73^J6_v-=%n60S(Wl& z%ck69`+Etq)ji3Z&%b^X<!^MZ8MEDyNJ3@C&foMc7ZT{bS-_DZHMvxKvA=zB`D0^n zLF0L2`;m_}8)pj2wnRJ6KBpV`YP0EX#NYVMrn;&M<(S;E`k~*3{ftj6@cZc{)T-I? zaJ8vtd|&&TZ%TLL&JFV1nMn%@srQnPW-gpLy(F+|Za5tm$AyU7a7jk3ntomV`rWO6 z)~nVyuF^(7L*&!V<cuJT0X@&jcWa)$jvP{5zC;}(DH<;v`>U%{1b7}WRE}1rg?N9; zS!b8cf868q@!ObBw(L?fSy9C3nlPs`V-DToD){T|iwjR*u(tHQy6HXa!=g3U4sOnj zG|I2KBL%uu`e=Bfw1ky&6C8a^jT>6dC^|DrmfbHXR!_=*3Zg=)wOkcJUWnw)o>2JW zSummfRT>CqctzlxIT{R^t|3p`ARSBlB1!RDwO-`2KS$L3ec1JPl^;Dt5TEdskz;a? zBR~ax%)$>QmpLI7kwPG`I}q={dt(Z*o`I`EGpThGFpZD29hUg6r%_M9lqdNB1<SF| zvS`$jl?u%$d=*<c!0A^|jb&lPT7+Tb%mEiC+=X6H#r8yn4+5o;5UV_P5JkNutI*XZ zZW8z`KGV3V{RYwfy6{f9a2bg^=`<5{>;d9o(#u;VwKrBHK8}A~6#FDzqXphtNG01| zuL~ci6zI!=JV&{lEIP$m6a>wprf?)ZiVA(Zr7~()ud6OM#gNmc=}np+t<6aiwLoJ_ zB|J$xJ?#D|^Mjw!r}K_-(h6_Gdf=cO{B#L9aP;G*3`V7sK19qA+0$%~kCSMH!>L*8 z@XtjJ1u%=$MgmPJCf`^#S43@OX|}c#6wmu5#Z8tmt2L0Xgz|&90f`NQUI>+Y%9~|k z1<I+hK*}i5<>O%A5CXuaR>6e_w}qFl@|fBQX_8T?Htbk4dzle6$QY*%vi3U<Hr9eG z6OxWafTtitcS+8CQdJ7H=bn1p)jtu%{dQ{ZZX=V1TK>za1n)5-y5?v?AU%LiDModW zXqM@e6^(Cg_8I+(g^F6W`EO-))u}65fZ(fvUx>Uv+OT?RYIlL+5{Tsu${#bB-g(eL zo3o<J%S@(jDSax2pn)h49%9POE)z}S)(&N0^3PMRj7_-|V3o{0NyG$AU{eRoE5mHd zVdY+Q_53fL2f3D6!YURZ^*II(LuMu_6s)pU@h^1PpD2zk<ITkIWV~t3m9BY+Jo9jS ztzsmMCnSIbA|%9U)(m8oFeYSBo6Nmcal6DNL$b_{Ur11=hU@x@G+fp8o?+O{ZeD_O zYaiNY>vG_Dq-L@V{Mw}wZG_F+g}&{#*L(fEbqh0FtQF(M*^TSffX8Q{MvnTjk5i$K zxXr-RRHEZHu&ESen_AnnsN1z`fmJd<K$S+}OvWjm6TV1mq;X7u{tn@-5U$ylFWROn za9Zfg_OYj{&6k&SlU@I|YI+@uJUNk87aWt_8eK^N4!%XSeyRkK_AT%PtnR|w_oDaV zB)~lQTRdi+u^Dw~{%5EDF4O*s&lDP+<ZrYl_%2r&u#`!rh}@9_ZdK}lIt<ve)_I-} znfnWS1V6rP=NxN8;>SxQj3Px1xZh-AZE4N|g+S-xpO5e~LtQE&tkOhD>xvTYpB<DF z&{d^exZ4Fw<n45^IjfgH&XUs1jKnLi_b^m9{X7)9);;^AB_BlK7`X0F*)foh#0!ac zc`6Gll_rdoc`<f{F)tRvkkDKomwVA9RapbXaOBGBPX6}iufuLTi*8qX>e!xLn5&Mn z&OJ$Y>?sAU-chM1UpT5*RBnaSJfl4kI`l9v2E^UdL^H}5ZQV>hM|d=RnT?b@vC%<3 z>S1@upnI)aZReKui#+R+9FuC2wqgaQkT+)C^(>W_A#B7X$%GzxH7j=)wbE$f+Zzx) zr|qaCXnJX$OJ-mE95j3dWm7St!Q(n*e<6S*upv~7qOes<hbI0x7mEbY+07&<PklPw zy6_cO$eI)WPP(4zV993!S39c)xn;vOATzZs6>_jp@u`w}N7*YCGfDM}PTxhs`FtJ< zwkoHq73SP|sACX8bw-^%5l`Y+;^Q@FLs)9LuteuYO`Xo+O9kdC=j_7@J-jTZN+iRT zw7%$sR8H&p!|EOwg<P;D-ON5IlcjR)mRXl>)K}~KS$7ABMLcf<m|Lxu^Ky0VqBT1s zyD~QGMzazCe|Z&JO|51-Fu%;%pcq!^bUuqH5CZsVlh_xY-wtz}XP{1SgfS-Sh2MQs zs>s{dcGBZSE|d#;z9rS_Zr^*oP&x-yS)Qgq^B0|-3-H1cWRqmDJIKtx{2J|QJ)=H| z(v>KYvV%>3+}3f`T`*|6#7n^{z8tu5X<C4Z6O<?J)Iua4NE6OOjc`afR(g7LVZQzI z7qQVB{YniEw)eiYnmA?Y!Us-hy`<yQOB21X6I5ehP)p&Y*l9(rT)VOklen}cQ43af z$zRw^g=V@voo#EmT&z}Fby?b*{;Jq1)_|i52}VqwqUA~~ZzkpPO<e39guFBaV5*t| z2}h}~mHJ9&@jddwv$>bXt$SX>BC72kcT}Qz5yD3QwvhGZ8VU7ao1)R|2_0<_U>#s# zlq={F$wMSnvxaP+al?(CWSMXUh~PQWSd*9)W{YIAjBb%<2(HOz4Ef%`>{7D$=4$3g zk?ArLs~=F)r&*i=S_4-jGr!Q%Dvon5H9xuJV9Z1ydLLrYtmro6mCN$7gRR-KXaE+L zzZ?QBaz~9f8`5uFL9JDcs&|VT#+fe7PUitK*X&l|L%EJ0ka^G{s;{)e%uy|Vw)N7R z1;s(%*CP7l>4N61)(duwrrX^-S4Hl%2KQFS4(WV6*`rab)1#RHO>MGpV-uSz(_zUT zA2j>Re{*p_SeM#H)V0y8)FnpV5L9T~H<J0FV?AXNdeLr_J{3ZlqQKaJTxfri{H-Y0 zpZv72*DD#`7_a!uZ3*!l&D;;N$|qdwv-MSld|-z4W%tGCvs(Le!}0xQgZR#S!<_!| zYLTt&*D#6YXk4PuR3!$AvnE5YgYfWHDDi$sxm_73>L!UJ13_phhd`*qWG`yN_Z1*U z1@0-pUoXQb!2M;vmXX+yU&~1L-$VEjzg3jxCbZ^PP0UP|)z$QtDfB`#{RtxJ0Vlvr z_|5?Et&K$b5Q2LU2uzb(=>;j<0~zgx5HOueSNB_0Xq$jiTfr+;UMTd`5$G7z1l6nI zzk}aH-8Qug$=72#2)b+D-Dsph2a6bJc#_z}6fJp+(eIx+_}gt<4GlS@gT37?9W7kV zt?k_{U0p5h`7KP{_7rh7$F8ilj8Y{B2mxhLNoE>?fxa)l3G@ZV_z#iE9G~<8`&otu zzi-g9<ePsI1D){pxKe$!xaKd^kY=YqMo5ExLG872jqUlw<rr7`+g%IXpY?m>VN^On zX&hb|&@_|$@whoZ&o7`-?{iVt#E6LumEW$@vfN?q@FP9~N>bvX>H5ei&i654E`61K z#!eO0w6yxEi?6zWG*A-bbnAG~<^#0DWB7k^n)gpx`v?C2K7XId*^Ych2!V;1Wn}_W z)gtc!q;rEZZi7zo*VVDbCOvu@2iJ^@$%%`B8)+FNB}7NVqjQ+Sq`E%%Ay4S(Z%fZ< zg|3i9ukd`KQdJ2Jg+*UdQU1(kfO^P47cz~LZO8Q(UIN8WDUZ63{K$5;gH(S6+VQ#n zW_!2hReZ>Cw#wnBp8XxL_vo}0d1im(?AH822&QEAm*H+4e#G7f2XVg-+5cDaD+D~< z@5CC3e*|Hcj;#G~$zRu@#0diZp^~@Yw{pj=bOh}Dk0@NZU+LH=NGgx=MP4PNlCPf5 zU(`vRwJlL#WOEFwlaH$XWch(OkLw!wMp<0?yK0Y&Ef)Tn0tSjnx0X-a@yMkq(je<_ zRE7`B*8Jb%QIKvJwUg1Y=ravSrDAK2dhlw1T$9CESrlP3d8~*xk=;qBbhZpO9{VQ! z$xwNlQA(Yyz^Y=7)>17aE^j%nr?g@U9t6eGy^E4kb+7pDzDkG7jodVEW|NXh=r0!> zdo5fOTQ4J%pMQc+JDLG{g!&<!7tbw{V|@BT10mUcJ{95GJ3;_6z@_MFr0}AqVvQ`k zs7S*tcsbf)ITzAFQ><Q5_EJ5a^t7{fulQv0#&yQmTB~@?QR#M{;Q~RHa^g)p6T_`# zZ{7gvowZ&%ShT=GJ#rT;H>$S7Oyv8n(B`Qf(N8}MJtEG_@jA>TDp8C=FF`Cx-_2c| z$*@~ZWC3Z&2TE|zrbtwtkbObh)FX6u;7Q6HWm1yw;?~IfZqFHjy~PM9-$T||^M;UK zlUc4p_1b&970@!Hv|kuwI@jY|JQ9=3bei}&mAU@D@@7RoZLFA0|NeQERvLQ4KPAN8 z^as<<@u#x=eFgkmg}Xqovr}EswcD$`Iujs=3pdF@T^_xi_pif+d)3m*)y4(8MT=F6 z>tN=dxd}bdUnVqRftLi;@PBNMV3@f%Ihr*|gdL@W_xNL!{&c&4XQJ5?2+Z8{>E89A zSrP1UI7(SJaC;oXq3!KqY3gQe>4JT>V;8&I<xZ=KAH5|_v+!Oh<9Pk^r#*dyS|P@4 z@3?tS-e%)5jPISvi?l*+nzg-;mt@N~jc}SAj*jW!$XxqdTJVS}i=kdh_}KABg3f8h z$2#gO476kC21$^4^bgM4$}XyWD6D?HN$nsyy)y8<Q^OBasY%hia65Dkg3#}uGx?wg zoPVm+KREMmm1-_Q9LmVJ3;3gq$OvhEAuA3Z&0$J)ZxjgdBXFj~-e}l6r2DtbK1!gS z!MxFZ^oQB6S)VfetQ~v;TEOmvJZLyM9w|CEKQ8G-80I&Q?Pz@o+&^K|RK;+93PWtU zN{7Ws50E&-!P17n{nN%>;IHK>2n+ZPMvVT_eth?A!pPM>A+T-w29v}_{MyN%z@JWH z%Sv`Eo6-Yr{T_&;g%A3>%f<*(Z1o1gVat&mOvEo`+AbO+Q?YY{L1XJ9UL5o}bi(&T zi5mxg#6P;rZo&@AB<yG}!i32VI<SAwz4T#}7q;0LAhx2xjfe*txQ{q!_TC4-Lt|zm z_SB@uiO5;>n7}1skH_5@V+0bmu^1xu6yv}l@`L|i?Ei*ih7|Vr!Zmjp4aYSXdrs|| ziy4d9=3<E0;{?}S9rW|&UI+zn(fo-24af9z>`u>s6N_V12hGK4>AUt~<`cHP7$kP* w<-|b_ppn0|_aD$PO%S_5;>I_T8jF6Ymt(g>q9d4w2}ZvzqeX@m4d%c902`pH9{>OV literal 0 HcmV?d00001 diff --git a/notebooks/Block 0/Checking_Correct_Installation.ipynb b/notebooks/Block 0/Checking_Correct_Installation.ipynb new file mode 100644 index 0000000..67bad2a --- /dev/null +++ b/notebooks/Block 0/Checking_Correct_Installation.ipynb @@ -0,0 +1,131 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Checking your installation\n", + "\n", + "Please check that the notebook below runs smoothly." + ] + }, + { + "cell_type": "code", + "execution_count": 1, + "metadata": {}, + "outputs": [ + { + "data": { + "text/plain": [ + "'3.7.7 (default, May 6 2020, 11:45:54) [MSC v.1916 64 bit (AMD64)]'" + ] + }, + "execution_count": 1, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "import sys\n", + "sys.version #Should work and give 3.7." + ] + }, + { + "cell_type": "code", + "execution_count": 2, + "metadata": {}, + "outputs": [ + { + "data": { + "text/plain": [ + "'2.1.0'" + ] + }, + "execution_count": 2, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "import tensorflow as tf\n", + "tf.__version__ #Should work and give 2.1.0" + ] + }, + { + "cell_type": "code", + "execution_count": 3, + "metadata": {}, + "outputs": [ + { + "data": { + "text/plain": [ + "'1.19.1'" + ] + }, + "execution_count": 3, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "import numpy as np \n", + "np.__version__ #Should work and give something > 1.19" + ] + }, + { + "cell_type": "code", + "execution_count": 4, + "metadata": {}, + "outputs": [ + { + "data": { + "text/plain": [ + "<matplotlib.collections.PathCollection at 0x17a7a929508>" + ] + }, + "execution_count": 4, + "metadata": {}, + "output_type": "execute_result" + }, + { + "data": { + "image/png": "iVBORw0KGgoAAAANSUhEUgAAAYIAAAD4CAYAAADhNOGaAAAABHNCSVQICAgIfAhkiAAAAAlwSFlzAAALEgAACxIB0t1+/AAAADh0RVh0U29mdHdhcmUAbWF0cGxvdGxpYiB2ZXJzaW9uMy4yLjIsIGh0dHA6Ly9tYXRwbG90bGliLm9yZy+WH4yJAAAei0lEQVR4nO3df7Bc5X3f8fcHWdgXx7XACCxdUKRmNNTEKSK5A06USTEGA6obYbcOwo1DM05VOiGNGQ+1qGda2plONCYJphnHtkJocZsa3BiDxhDLGMWlJmObi5GN+CGjYDC6UpFsIzsOaizg2z/2LF4t+/Pu2d1znufzmtHc3fPj7nNW95zv8+P7nKOIwMzM8nXctAtgZmbT5UBgZpY5BwIzs8w5EJiZZc6BwMwsc6+adgEW4+STT47Vq1dPuxhmZrXy4IMPfjcilrcvr2UgWL16NfPz89MuhplZrUh6utNydw2ZmWXOgcDMLHMOBGZmmXMgMDPLnAOBmVnmSskaknQz8A7gYES8ucN6ATcCG4DngX8REV8v1l1crFsC3BQRW8soUyrueGiB63fsYf/hI7x+ZikSHH7+KCuXzXDNRWdw6dmz0y6i2dj5PBgvlXH3UUm/AvwI+GSXQLAB+B0ageBc4MaIOFfSEuBbwIXAPuAB4PKIeLTX583NzUUO6aN3PLTAtbc/zJGjL3ZcLyCAWZ8MlqDmxX/h8JGX/9Y78XkwOEkPRsRc+/JSWgQRcZ+k1T022UgjSATwFUnLJK0AVgN7I+LJopC3Ftv2DASpaz0BemmeGAuHj3Dt7Q8D+CSwJLRXgnpVV30ejG5SYwSzwDMt7/cVy7otfwVJmyXNS5o/dOjQ2Ao6bc0ToF8QaHfk6It84NPfYM2Wu1i/dSd3PLQwphKajc8dDy2wfutO3n/brq4t4V6OHH2R99+2y+fAkCY1s1gdlkWP5a9cGLEN2AaNrqHyilYNg7YCenmx6OZzzcjqqF9X6DB8DgxnUi2CfcDpLe9PA/b3WJ6VxbYCejly9EWu37GntN9nNm7X79hTShBo8jkwuEkFgu3Ab6jhLcAPIuIAjcHhtZLWSDoe2FRsm5VBT4BlM0s58YSlQOemVLuFw0fcRLbKa3YH9asINf/mhzkPfA4Mpqz00U8B5wEnS9oH/AdgKUBEfBy4m0bG0F4a6aO/Wax7QdJVwA4a6aM3R8QjZZSpDgbtDppZuoTfe9fPHdPEbU2nO056uVuonZvIVmWDdgd1ywga5BzyOdBfKemjk5ZC+uioJ8Cwv2t22Qz3bzl/0eU1G4d+LYFOlaBOfA4MZqzpoza8ft1Bg54A8JNaTq+aUbOJ7Dxrq5L9PYLAMPMCBjkHen1W7nyLiSnpdwIMGgSaLj17lvu3nM/sspmu2zSbyO4vtWlrjgt0649o1t7LPAcCPF7QhQPBhI3jBGh1zUVnMLN0Sdf1zqSwaeuXJTezdAnXXHTGon9/r3PAlaHOHAgmaNwnADRqRb/3rp/r2TJwE9mmqVe36GJaw+36nQOuDL2SA8EEjfsEaOrXRF7ZI0iYjVu3iohgpNZwq+Y50C291JWhYzkQTNAkToBWnZrIwrnVNl3dKiLjqKBM8rPqzIFggib9R9neRG69g6P7Sm3SWieOtdfUy+gW7cSVocE4EEzANE6AptZuovYBaveV2qS0j4+13miszG7Rdq4MDcaBYMymdQK069Yt5b5Sm4RO42PNZwiMo1u0lStD/XlC2Zj1OwEmZeWymY7ZSu4rtUmoQkWkCmWoKrcIxqwqf3zuK7VpqsKgbRXKUFUOBGNWlT8+95XaNHWqiIx7fGyQMrgy1OBAMGZVOAGa3Fdqk9ZMlLj6tl28+lXHceIJSxGTHR9rcmWoO48RjEnrbaJfP7OU1yw9jsPPH2VlBR6wXZXuKktb+x1BDx85yszSJdxw2bqp/f1fevYsl5492/Gup83KUI43ZXQgGIMqngCtPHBsk9ApUaIqF1tXho7lrqEx6HUCVEGVuqssXVW+2FZl7K4qSgkEki6WtEfSXklbOqy/RtKu4t9uSS9KOqlY95Skh4t19X7aTKHKJwAc21cqGo/+e83S47j6tl3ZD5pZeap8sXVl6FgjBwJJS4CPApcAZwKXSzqzdZuIuD4i1kXEOuBa4H9HxPdbNnlrsf4VT86poyqfAE3NgeMbLlvH373wEs89f5TAg2ZWnipfbNsrQ7PLZvinvzDL9Tv2sGbLXdlViMoYIzgH2BsRTwJIuhXYCDzaZfvLgU+V8LmVdc1FZ7zisXlVOQHaVbkf1+qnNUliZXFx/cvHD738ftqJEq2aA8fwynG93J5zXEYgmAWeaXm/Dzi304aSTgAuBq5qWRzAFyQF8ImI2NZl383AZoBVq1aVUOzyVTlTqJuqd2NZfXS6mH7mwYWJp4kuRu4VojICQadbfnd7ANc/Ae5v6xZaHxH7JZ0C3CPp8Yi47xW/sBEgtkHj4fWjFrpsVc8U6sYZRFaWOl9Mc68QlTFYvA84veX9acD+Lttuoq1bKCL2Fz8PAp+l0dVUO1XPFOqmyv24Vi91vpjWYVxvnMoIBA8AayWtkXQ8jYv99vaNJL0e+EfAnS3LXivpdc3XwNuB3SWUaeLqehJ0GjSrQ1PeqqfOF9PcK0Qjdw1FxAuSrgJ2AEuAmyPiEUlXFus/Xmz6TuALEfG3LbufCnxWUrMs/zMiPj9qmaahzl0s7YNm1+/Yw9W37ar02IZVT52SJNo1/8ZbB7pz+ttXROW62/uam5uL+flqTTloHyOAxklQp9p1Csdg09WeNZTTxbQOJD3YKU3ft5goSQo1ijoP9tn0pHjxT/GYenEgGFFKfzB1Heew6Ukx/z7FY+rH9xoaQetjKFOYlVvnwT6bjrpmy/WS4jH140AwgtT+YHLPnLDhpdiKTPGY+nEgGEFqfzBOJbVhpdiKTPGY+vEYwQjqnDLaTWsqqVk/dU4Z7SbFY+rHgWAEqf/BpDQQbuORQrZcuxSPqR/PIxhRqhdLzykwa0jpHPc8gjFJtSvFcwqsl5Qujr3kkkrqQLAIOZwEqQ2EW3lyuThCPhUiZw0NKbW5A93kmDlhg0ktbbqXXCpEDgRDyuUk8JwC6yaXiyPkUyFyIBhSLieB5xRYN7lcHCGfCpHHCIaU4tyBblIdCLfRpJ423SqXVFIHgiHldBK0ymGA3AaTy8WxKYcKUSmBQNLFwI00HkxzU0RsbVt/Ho0nk327WHR7RPynQfatmtxOAsgrS8QGk8PFMScjBwJJS4CPAhfSeH7xA5K2R8SjbZv+n4h4xyL3rZTcToJcUuisN7cK0/0OyhgsPgfYGxFPRsSPgVuBjRPY1yYklwFy6y6XtOleUv4OyggEs8AzLe/3Fcva/aKkb0j6C0k/O+S+U3fHQwus37qTNVvuYv3WnUn85w8qpywR6yyXtOleUv4OyggE6rCs/QZGXwd+OiLOAv4IuGOIfRsbSpslzUuaP3To0KILuxgp1wQGkUsKnXXnVmHa30EZgWAfcHrL+9OA/a0bRMQPI+JHxeu7gaWSTh5k35bfsS0i5iJibvny5SUUe3Ap1wQG4TkF5lZh2t9BGVlDDwBrJa0BFoBNwHtaN5D0RuDZiAhJ59AIQN8DDvfbtwpSrgkMKrcBcjtWrmnTrVL+DkYOBBHxgqSrgB00UkBvjohHJF1ZrP848M+Afy3pBeAIsCka97/uuO+oZSpbTpPIzDrJMW26XcrfgZ9HMADfm/9YqabQmaXOzyMYQco1gWF5cplZQ0oVIgeCAbmPvMGTy/KS0sWuTKlViHz3URuKB87zkXvadC+pZRI6EHSR8wSyXlJOobNjpXaxK1NqFSIHgg5cE+rOk8vykdrFrkypVYgcCDpwTag7Ty7LR2oXuzKlViHyYHEHrgn15oHzPKQ8gWpUqWUSOhB04AlkZuld7MqWUoXIgaAD14QG5/TCtKV0sbPuHAg6cE1oMKnlUpvlyoGgC9eE+vPksjS5lTe8un9nDgS2aB5UT49becNL4Ttz+mgLTyIbjtML0+PU6eGl8J05EBQ8iWx4qeVSm1t5i5HCd+ZAUEghqk+aJ5elx6284aXwnXmMoJBCVJ8GD6qnxanTw0vhOyulRSDpYkl7JO2VtKXD+n8u6ZvFv7+SdFbLuqckPSxpl6TJPW2mTQpR3WxUbuUNL4XvbOQnlElaAnwLuJDGw+gfAC6PiEdbtvkl4LGIeE7SJcB1EXFuse4pYC4ivjvoZ47jCWV+Ctno6p5CZ5a6cT6h7Bxgb0Q8WXzQrcBG4OVAEBF/1bL9V4DTSvjcUnkS2WhSSKEzy1UZgWAWeKbl/T7g3B7bvw/4i5b3AXxBUgCfiIhtnXaStBnYDLBq1aqRCtyN+7sXz5PLzBrq2DIuIxCow7KO/U2S3kojEPxyy+L1EbFf0inAPZIej4j7XvELGwFiGzS6hkYvtpXJg+31VseLVxXVtWVcxmDxPuD0lvenAfvbN5L0D4GbgI0R8b3m8ojYX/w8CHyWRlfTxHgSWTk82F5fnkNTnrqmoZcRCB4A1kpaI+l4YBOwvXUDSauA24H3RsS3Wpa/VtLrmq+BtwO7SyjTQHwClMeTy+qrrhevKqpry3jkQBARLwBXATuAx4BPR8Qjkq6UdGWx2b8H3gD8cVua6KnAlyV9A/gacFdEfH7UMg3KJ0B5Ukihy1VdL15VVNeWcSkTyiLibuDutmUfb3n9W8BvddjvSeCs9uWT4hOgXB5sryc/iKk8dZ1clvUtJuoavc3K5G698tS1ZZz1LSbqGr3NyuQ5NOWqY8s460DgE2B8nI5YL3W8eFl5sg4E4BNgHOqaS22Wq+wDgZXPs4zNGurSMnYgsNI5G6se6nKRqqs6tYyzzBrybOLxcjZW9Xky5fjVaZ5SdoHAJ8D4OR2x+up0kaqrOrWMswsEPgHGr6651Dmp00WqrurUMs5ujMAnwGQ4G6vaPJt4/Oo0Tym7FkGdorTZuLj7bvzq1DLOrkVQpyhtNi6eTDkZdWkZZxcIfAJMntMUq6kuFykbv+wCAfgEmKQ65VKb5SrLQGCT41nG1eLW2fRU+bt3ILCxcpZWdbh1Nj1V/+5LyRqSdLGkPZL2StrSYb0k/Zdi/Tcl/fyg+5bFs4mnw1la1eE5NNNT9e9+5EAgaQnwUeAS4Ezgcklntm12CbC2+LcZ+NgQ+47Ms4mnx2mK1eHW2fRU/bsvo0VwDrA3Ip6MiB8DtwIb27bZCHwyGr4CLJO0YsB9R1b1aJyyOuVSp86ts+mp+ndfxhjBLPBMy/t9wLkDbDM74L4ASNpMozXBqlWrhipg1aNx6pylVQ2eQzM9Vf/uy2gRqMOyGHCbQfZtLIzYFhFzETG3fPnyoQpY9WhsNglunU1P1b/7MloE+4DTW96fBuwfcJvjB9h3ZFWPxmaT4tbZ9FT5uy8jEDwArJW0BlgANgHvadtmO3CVpFtpdP38ICIOSDo0wL4j82ziaqlyPrVZjkYOBBHxgqSrgB3AEuDmiHhE0pXF+o8DdwMbgL3A88Bv9tp31DJ1UuVonJOq51ObTULVKkOK6NglX2lzc3MxPz8/7WLYIqzfurPj7Y9nl81w/5bzp1Ci9FXtopO79soQNLqqJzFmIOnBiJhrX57dbahtupzBNVmeQ1M9VUxndyCwiXIG12RV8aKTuypWhhwIbKI803iyqnjRyV0VK0MOBDZRVc+nTk0VLzq5q2JlyHcftYlzBtfkeA5N9VQxnd2BwCxhVbzoWPUqQw4EZomr2kXHqseBwKbKOe5m0+dAYFPjWcZm1agMORDY1Ph5xuNThYuL9VeVypDTR21qnOM+Hp5NXB9VmfDnQGBT4xz38ajKxcX6q0plyIHApqaKE2tSUJWLi/VXlcqQA4FNjWcZj0dVLi7WX1UqQx4stqlyjnv5PJu4Pqoy4c+BwCwxVbm42GCqUBkaKRBIOgm4DVgNPAX8WkQ817bN6cAngTcCLwHbIuLGYt11wL8EDhWb/7uIuHuUMll9OeWxPFW4uFh9jDpGsAW4NyLWAvcW79u9AHwgIt4EvAX4bUlntqy/ISLWFf8cBDLllEez6Rk1EGwEbile3wJc2r5BRByIiK8Xr/8GeAxwVcWO4ZRHs0aFaP3WnazZchfrt+6cWEVo1DGCUyPiADQu+JJO6bWxpNXA2cBXWxZfJek3gHkaLYfnOuyKpM3AZoBVq1aNWGyrGqc8js5da/U2zVnGfVsEkr4oaXeHfxuH+SBJPwV8Bnh/RPywWPwx4GeAdcAB4A+67R8R2yJiLiLmli9fPsxHWw045XE07lqrv2m2ivsGgoi4ICLe3OHfncCzklYAFD8PdvodkpbSCAJ/FhG3t/zuZyPixYh4CfgT4JwyDsrqpyr51HXlrrX6m2areNQxgu3AFcXrK4A72zeQJOBPgcci4g/b1q1oeftOYPeI5bGa8uSy0bhrrf6m2SoedYxgK/BpSe8DvgO8G0DSSuCmiNgArAfeCzwsaVexXzNN9MOS1gFBI/30X41YHqsxpzwu3splMyx0uOi7a60+pjkRcKRAEBHfA97WYfl+YEPx+suAuuz/3lE+38waPJu4/qY5EdAzi80S4NnEaZhWq9iBwCrJqZDDc9eaLZYDgVVOVZ7aZDZNk6wMORBY5fgRloNzyylNk64M+XkEVjlOhRyMJ5Gla9LzQhwIrHI8y3gwnkSWrklXhhwIrHI8y3gwbjmla9KVIQcCqxzPMh6MW07pmnRlyIPFVklOhezPk8jSNel5IQ4EZjXlSWRpm2RlyIHAKs8pkt255WRlcCCwSvPkMrOGcVaIHAis0jy57FhuHeVp3BUiZw1ZpTlF8ic8gSxf454z4kBgleYUyZ/wBLJ8jbtCNFIgkHSSpHskPVH8PLHLdk9JeljSLknzw+5v+fLksp9w6yhf464Qjdoi2ALcGxFrgXuL9928NSLWRcTcIve3DHly2U+4dZSvcVeIRh0s3gicV7y+BfgS8MEJ7m8ZcIpkgyeQ5Wvcc0YUEYvfWTocEcta3j8XEa/o3pH0beA5Gs8m/kREbBtm/2LdZmAzwKpVq37h6aefXnS5rb5yz5rJ/fhtNJIebOuVaSzvFwgkfRF4Y4dVHwJuGTAQrIyI/ZJOAe4Bfici7hsmELSam5uL+fn5fptZYtpT6KBRI861q8hsWN0CQd+uoYi4oMcvfVbSiog4IGkFcLDL79hf/Dwo6bPAOcB9wED7m4HnFJiNy6iDxduBK4rXVwB3tm8g6bWSXtd8Dbwd2D3o/mZNuWbN3PHQAuu37mTNlrtYv3Wn5w1Y6UYNBFuBCyU9AVxYvEfSSkl3F9ucCnxZ0jeArwF3RcTne+1v1kmOWTOeRGaTMFLWUER8D3hbh+X7gQ3F6yeBs4bZ36yTHLNm3B1mk+B7DVlt5Hjb5Vy7w2yyHAisVnKbU7By2QwLHS76KXeH2eT5XkNmFeZbbNgkuEVgtZXD5Kocu8Ns8hwIrJZSf2BNDkHOqsNdQ1ZLKd+S2SmjNmkOBFZLKWfTpBzkrJocCKyWUp5clnKQs2pyILBaSjmbJuUgZ9XkQGC1lPIDa1IOclZNIz2PYFp8G2prl1qWTWrHY9Ww6NtQm1Vdiqmkuc2gtulyILDaS+XGbG4F2LQ4EFjtpZBlk2KrxurDg8VWeylk2XjugE2TA4HVXgpZNim0aqy+RgoEkk6SdI+kJ4qfnR5cf4akXS3/fijp/cW66yQttKzbMEp5LE8ppJKm0Kqx+hopfVTSh4HvR8RWSVuAEyPigz22XwIsAOdGxNOSrgN+FBG/P8znOn3UeqnjoGv7GAE0WjV1C2hWbeNKH90InFe8vgX4EtA1ENB4LOVfR8TTI36uWUd1G3RtDVqvn1nKa5Yex+Hnj9YmgFkaRh0jODUiDgAUP0/ps/0m4FNty66S9E1JN3fqWmqStFnSvKT5Q4cOjVZqS1adBl3b7zJ6+MhR/t/Rl7jhsnXcv+V8BwGbmL6BQNIXJe3u8G/jMB8k6XjgV4H/1bL4Y8DPAOuAA8AfdNs/IrZFxFxEzC1fvnyYj7aM1GnQtU5By9LWt2soIi7otk7Ss5JWRMQBSSuAgz1+1SXA1yPi2Zbf/fJrSX8CfG6wYpt1Vqdn/NYpaFnaRu0a2g5cUby+Arizx7aX09YtVASPpncCu0csj2WuTqmkzhSyqhg1EGwFLpT0BHBh8R5JKyXd3dxI0gnF+tvb9v+wpIclfRN4K3D1iOWxzLWnki4rBmCvvm0X67furNRTvuoUtCxtvvuoJauqKZntmUISzhSyifDdRy07VbwZXXtwOnzkKDNLl3DDZescAGxqfIsJS1YVB2OdKWRV5EBgyariYGwVg5OZA4Elq9NgrGjMNp7WwHEVg5OZxwgsWc0+9+t37GHh8BEENFMjJn3rieYAcXs5wJlCNn1uEVjSLj17lvu3nM/sshna8+Mm1TffeisJaAQBFevqeKdUS49bBJaFafbNdxogDhpB4P4t54/98836cYvAsjDNvnkPEFvVORBYFqY5cOwBYqs6dw1ZFqYxcOwBYqsLtwgsG5McOPYAsdWJA4Flp1vffJndRP0GiB0ErEocCCw7vfrmm91Eiw0Gdzy0wPqtOzs+EwE8QGzV5EBg2ek0cNxqsd1E7d1BnXiA2KrIg8WWnfaB404WDh9hzZa7Bro1dOugcC8eILaq8vMILGu9unGamhk/sx2CQqdnHnTSaV+zSev2PIKRAoGkdwPXAW8CzomIjldnSRcDNwJLgJsiovkks5OA24DVwFPAr0XEc/0+14HAyjLohbypGRSWFQ+Uee75o3338Qxiq4pugWDUMYLdwLuA+3p88BLgozQeXn8mcLmkM4vVW4B7I2ItcG/x3mxi2h9t2U+z2nT4yNGBgoC7g6wORhojiIjHAKSep9A5wN6IeLLY9lZgI/Bo8fO8YrtbgC8BHxylTGbDuvTs2Ze7bAbpKhqUu4OsLiaRNTQLPNPyfl+xDODUiDgAUPw8pdsvkbRZ0ryk+UOHDo2tsJa3fhlFg5hZuoSPXLbO8wWsNvq2CCR9EXhjh1Ufiog7B/iMTs2FoQcmImIbsA0aYwTD7m82iF63ohiEWwFWR30DQURcMOJn7ANOb3l/GrC/eP2spBURcUDSCuDgiJ9lNrLWrqJe9wtqNbN0iW8bYbU1iXkEDwBrJa0BFoBNwHuKdduBK4Ctxc9BWhhmE9MpKOw/fITXF1lDh58/OtBcA7MqGzV99J3AHwHLgcPAroi4SNJKGmmiG4rtNgAfoZE+enNE/Odi+RuATwOrgO8A746I7/f7XKePmpkNbyzzCKbFgcDMbHjjmkdgZmY150BgZpY5BwIzs8w5EJiZZa6Wg8WSDgFPL3L3k4HvllicusjxuHM8ZsjzuHM8Zhj+uH86Ipa3L6xlIBiFpPlOo+apy/G4czxmyPO4czxmKO+43TVkZpY5BwIzs8zlGAi2TbsAU5Ljced4zJDnced4zFDScWc3RmBmZsfKsUVgZmYtHAjMzDKXVSCQdLGkPZL2Skry+ciSTpf0l5Iek/SIpN8tlp8k6R5JTxQ/T5x2WcsmaYmkhyR9rnifwzEvk/Tnkh4v/s9/MfXjlnR18be9W9KnJL0mxWOWdLOkg5J2tyzrepySri2ubXskXTTMZ2UTCCQtAT4KXAKcCVwu6czplmosXgA+EBFvAt4C/HZxnFuAeyNiLXBv8T41vws81vI+h2O+Efh8RPwD4Cwax5/scUuaBf4NMBcRb6Zxa/tNpHnM/w24uG1Zx+MszvFNwM8W+/xxcc0bSDaBADgH2BsRT0bEj4FbgY1TLlPpIuJARHy9eP03NC4MszSO9ZZis1uAS6dTwvGQdBrwj4GbWhanfsx/D/gV4E8BIuLHEXGYxI+bxgO1ZiS9CjiBxhMPkzvmiLgPaH8+S7fj3AjcGhF/FxHfBvbSuOYNJKdAMAs80/J+X7EsWZJWA2cDXwVOjYgD0AgWwCnTK9lYfAT4t8BLLctSP+a/DxwC/mvRJXaTpNeS8HFHxALw+zQeZHUA+EFEfIGEj7lNt+Mc6fqWUyBQh2XJ5s5K+ingM8D7I+KH0y7POEl6B3AwIh6cdlkm7FXAzwMfi4izgb8ljS6Rroo+8Y3AGmAl8FpJvz7dUlXCSNe3nALBPuD0lven0WhSJkfSUhpB4M8i4vZi8bOSVhTrVwAHp1W+MVgP/Kqkp2h0+Z0v6X+Q9jFD4296X0R8tXj/5zQCQ8rHfQHw7Yg4FBFHgduBXyLtY27V7ThHur7lFAgeANZKWiPpeBoDK9unXKbSSRKNPuPHIuIPW1ZtB64oXl8B3Dnpso1LRFwbEadFxGoa/687I+LXSfiYASLi/wLPSDqjWPQ24FHSPu7vAG+RdELxt/42GuNgKR9zq27HuR3YJOnVktYAa4GvDfxbIyKbf8AG4FvAXwMfmnZ5xnSMv0yjSfhNYFfxbwPwBhpZBk8UP0+adlnHdPznAZ8rXid/zMA6YL74/74DODH14wb+I/A4sBv478CrUzxm4FM0xkGO0qjxv6/XcQIfKq5te4BLhvks32LCzCxzOXUNmZlZBw4EZmaZcyAwM8ucA4GZWeYcCMzMMudAYGaWOQcCM7PM/X9qfhSRSmlCegAAAABJRU5ErkJggg==\n", + "text/plain": [ + "<Figure size 432x288 with 1 Axes>" + ] + }, + "metadata": { + "needs_background": "light" + }, + "output_type": "display_data" + } + ], + "source": [ + "import matplotlib.pyplot as plt\n", + "%matplotlib inline\n", + "plt.scatter(range(100), np.sin(0.1 * np.array(range(100))))" + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.7.7" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/notebooks/Block 0/Exercise Sheet - Basics Numpy.ipynb b/notebooks/Block 0/Exercise Sheet - Basics Numpy.ipynb new file mode 100644 index 0000000..ce2bb78 --- /dev/null +++ b/notebooks/Block 0/Exercise Sheet - Basics Numpy.ipynb @@ -0,0 +1,473 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Problem 1 - Introduction Numpy" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "This is just a short programming quiz that asks you use a few NumPy features. It is meant to give you a little practice if you don't have NumPy experience" + ] + }, + { + "cell_type": "code", + "execution_count": 1, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Input as Array: None\n", + "Input minus min: None\n", + "Input Array: None\n", + "Multiply 1:\n", + "None\n", + "Multiply 2:\n", + "None\n", + "Multiply 3:\n", + "None\n", + "Mean == None\n" + ] + } + ], + "source": [ + "import numpy as np\n", + "\n", + "\n", + "def prepare_inputs(inputs):\n", + " # TODO: create a 2-dimensional ndarray from the given 1-dimensional list;\n", + " # assign it to input_array\n", + " input_array = None\n", + " \n", + " # TODO: find the minimum value in input_array and subtract that\n", + " # value from all the elements of input_array. Store the\n", + " # result in inputs_minus_min\n", + " inputs_minus_min = None\n", + "\n", + " # TODO: find the maximum value in inputs_minus_min and divide\n", + " # all of the values in inputs_minus_min by the maximum value.\n", + " # Store the results in inputs_div_max.\n", + " inputs_div_max = None\n", + "\n", + " # return the three arrays we've created\n", + " return input_array, inputs_minus_min, inputs_div_max\n", + " \n", + "\n", + "def multiply_inputs(m1, m2):\n", + " # TODO: Check the shapes of the matrices m1 and m2. \n", + " # m1 and m2 will be ndarray objects.\n", + " #\n", + " # Return False if the shapes cannot be used for matrix\n", + " # multiplication. You may not use a transpose\n", + " pass\n", + "\n", + "\n", + " # TODO: If you have not returned False, then calculate the matrix product\n", + " # of m1 and m2 and return it. Do not use a transpose,\n", + " # but you swap their order if necessary\n", + " pass\n", + " \n", + "\n", + "def find_mean(values):\n", + " # TODO: Return the average of the values in the given Python list\n", + " pass\n", + "\n", + "\n", + "input_array, inputs_minus_min, inputs_div_max = prepare_inputs([-1,2,7])\n", + "print(\"Input as Array: {}\".format(input_array))\n", + "print(\"Input minus min: {}\".format(inputs_minus_min))\n", + "print(\"Input Array: {}\".format(inputs_div_max))\n", + "\n", + "print(\"Multiply 1:\\n{}\".format(multiply_inputs(np.array([[1,2,3],[4,5,6]]), np.array([[1],[2],[3],[4]]))))\n", + "print(\"Multiply 2:\\n{}\".format(multiply_inputs(np.array([[1,2,3],[4,5,6]]), np.array([[1],[2],[3]]))))\n", + "print(\"Multiply 3:\\n{}\".format(multiply_inputs(np.array([[1,2,3],[4,5,6]]), np.array([[1,2]]))))\n", + "\n", + "print(\"Mean == {}\".format(find_mean([1,3,4])))" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Problem 2 - Body Mass Index" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "The goal is to write a function which can calculate the Body Mass Index (BMI) of a given dataset. BMI is given by:\n", + "\n", + "$$ BMI = \\frac{Weight}{Length^2} $$\n", + "\n" + ] + }, + { + "cell_type": "code", + "execution_count": 2, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "The given weights and lengths result in BMI's: \n", + "None\n" + ] + } + ], + "source": [ + "# import numpy\n", + "import numpy as np\n", + "np.set_printoptions(precision=2)\n", + "\n", + "def BMI(weight, length):\n", + " # Function returning the BMI of input vectors m and l\n", + " return \n", + "\n", + "\n", + "m_example = [60, 72, 57, 90, 95, 72]\n", + "l_example = [1.75, 1.80, 1.65, 1.90, 1.74, 1.91]\n", + "print(\"The given weights and lengths result in BMI's: \\n{}\".format(BMI(m_example, l_example)))\n", + " " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Problem 3 - Using Pandas: Weather" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "In this problem you will have to make use of **Pandas** to load and analyse a small, fictional database weather.csv (the same as used in the Script).\n", + "The data containes the temperature in 4 cities over 6 months. Download the dataset and save it somewhere practically, possibly in the same folder as this notebook." + ] + }, + { + "cell_type": "code", + "execution_count": 3, + "metadata": {}, + "outputs": [], + "source": [ + "# First import Pandas\n", + "import pandas as pd\n", + "\n", + "# load the database using pandas.read_csv. The file location is different for everyone. If you made a new folder in this folder named \"data\", the path would be ./data/weather.csv\n", + "# Example: data = pd.read_csv(\"/data/weather.csv\")\n", + "data = None\n", + "\n", + "data" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Viewing Data using Indices:\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Using the names of rows and columns (not integer indices), find:\n", + "- Temperature in Basel for all months\n", + "- Temperature in Chur in February\n" + ] + }, + { + "cell_type": "code", + "execution_count": 4, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Temperature in Basel is:\n", + " None \n", + "\n", + "Temperature in Chur in February is:\n", + " None\n" + ] + } + ], + "source": [ + "t_basel = None\n", + "t_chur_feb = None\n", + "\n", + "print(\"Temperature in Basel is:\\n\", t_basel, \"\\n\")\n", + "print(\"Temperature in Chur in February is:\\n\", t_chur_feb)" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Changing Indices" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Now we will look at the indices themselves. \n", + "- Find the name of column 3 using Python\n", + "- Change \"Basel\" to \"Bern\"" + ] + }, + { + "cell_type": "code", + "execution_count": 5, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "None\n" + ] + } + ], + "source": [ + "# Find the name of column 3:\n", + "name_c3 = None\n", + "print(name_c3)\n", + " \n", + "# Change \"Basel\" to \"Bern\"\n", + "\n", + "data" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### .mean() Method:\n", + "Now find :\n", + "- the average temperature in Chur (for the given Period)\n", + "- the average temperature in Spring in Switzerland (spring is Mar, Apr, May, mean of all cities)" + ] + }, + { + "cell_type": "code", + "execution_count": 6, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Average temperature in Chur was: None\n", + "Average temperature in Spring was: 0\n" + ] + } + ], + "source": [ + "t_chur_mean = None\n", + "\n", + "\n", + "t_spring_mean = 0\n", + "# Hint: mean() on a DataFrame gives the result in a Serries. The axis of the function to be applied on can be set with axis={index (0), columns (1)}.\n", + "# To find the mean of the whole matrix, the mean method can be applied twice\n", + "\n", + "\n", + "print(\"Average temperature in Chur was: {}\".format(t_chur_mean))\n", + "print(\"Average temperature in Spring was: {}\".format(round(t_spring_mean, 1)))" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### .sort_values() Method:\n", + "- Sort the data based on the temperature in Zürich\n", + "- Sort the data based on decreasing temperature in Basel" + ] + }, + { + "cell_type": "code", + "execution_count": 7, + "metadata": {}, + "outputs": [], + "source": [ + "# Sort data based on Zurich" + ] + }, + { + "cell_type": "code", + "execution_count": 8, + "metadata": {}, + "outputs": [], + "source": [ + "# Sort data based on Basel, descending with temperature" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Problem 4: Fuel Consumption\n", + "In this exercise, you will analyse a dataset containing information on Fuel consumption of cars in the eighties. The data contains 3 columns, the weight of the car in Pounds(1 Pound = 0.454 kg), the range in Miles per Gallon(1 mile=1.61 km; 1 gallon=3.79 l), and the type of car. Download the dataset and save it somewhere practically, possibly in the same folder as this notebook." + ] + }, + { + "cell_type": "code", + "execution_count": 15, + "metadata": {}, + "outputs": [], + "source": [ + "# First import Pandas\n", + "import pandas as pd\n", + "\n", + "# load the database using pandas.read_csv. The file location is different for everyone. If you made a new folder in this folder named \"data\", the path would be ./data/d.fuel.dat\n", + "# Example: data = pd.read_csv(\"/data/d.fuel.dat\")\n", + "data = None\n", + "\n", + "data" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + " To get a quick overview, we can view only the first 5 rows of the dataset. Print the first five rows using:\n", + " - **dataframe.loc**\n", + " - **DataFrame.head()** " + ] + }, + { + "cell_type": "code", + "execution_count": 16, + "metadata": {}, + "outputs": [], + "source": [ + "# Print the first 5 rows using data.loc\n" + ] + }, + { + "cell_type": "code", + "execution_count": 17, + "metadata": {}, + "outputs": [], + "source": [ + "# print the first 5 rows using data.head()\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### .mean() Method:\n", + "Now find :\n", + "- the average range of all cars\n", + "- the average range of all cars with type \"Medium\" (hint, select all rows with a certain constraint using **DataFrame[DataFrame[** *column* **].isin([** *values* **])]**\n" + ] + }, + { + "cell_type": "code", + "execution_count": 20, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Average miles per galon is: \n", + "0 \n", + "Average miles per galon for all Medium type cars is: \n", + "0\n" + ] + } + ], + "source": [ + "avg_mpg = 0\n", + "avg_medium = 0\n", + "\n", + "print(\"Average miles per galon is: \\n{}\".format(round(avg_mpg, 2)), \"\\nAverage miles per galon for all Medium type cars is: \\n{}\".format(round(avg_medium,2)))" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Conversion to SI units\n", + "- Create a Series containing the range in km/l and another Series containing the weight in kg.\n", + "- Find the average of these new Vectors\n" + ] + }, + { + "cell_type": "code", + "execution_count": 27, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Empty DataFrame\n", + "Columns: []\n", + "Index: []\n", + "Empty DataFrame\n", + "Columns: []\n", + "Index: []\n", + "\n", + "Average Kilometer per liter is: \n", + "Series([], dtype: float64) \n", + "Average weight in kilogram is: \n", + "Series([], dtype: float64)\n" + ] + } + ], + "source": [ + "t_kml = pd.DataFrame()\n", + "t_kg = pd.DataFrame()\n", + "\n", + "print(t_kml.head())\n", + "print(t_kg.head())\n", + "\n", + "avg_kml = t_kml.mean()\n", + "avg_kg = t_kg.mean()\n", + "print(\"\\nAverage Kilometer per liter is: \\n{}\".format(round(avg_kml, 2)), \"\\nAverage weight in kilogram is: \\n{}\".format(round(avg_kg,2)))" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python [conda env:root]", + "language": "python", + "name": "conda-root-py" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.8.3" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/notebooks/Block 0/Solution - Basics Numpy.ipynb b/notebooks/Block 0/Solution - Basics Numpy.ipynb new file mode 100644 index 0000000..fd04a3a --- /dev/null +++ b/notebooks/Block 0/Solution - Basics Numpy.ipynb @@ -0,0 +1,1507 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Solution to Problem 1" + ] + }, + { + "cell_type": "code", + "execution_count": 1, + "metadata": {}, + "outputs": [], + "source": [ + "# Use the numpy library\n", + "import numpy as np\n", + "np.set_printoptions(precision=2)\n", + "\n", + "\n", + "######################################################\n", + "#\n", + "# MESSAGE TO STUDENTS:\n", + "#\n", + "# This file contains a solution to the coding quiz. Feel free\n", + "# to look at it when you are stuck, but try to solve the\n", + "# problem on your own first.\n", + "#\n", + "######################################################\n", + "\n", + "\n", + "def prepare_inputs(inputs):\n", + " # TODO: create a 2-dimensional ndarray from the given 1-dimensional list;\n", + " # assign it to input_array\n", + " input_array = np.array([inputs])\n", + " \n", + " # TODO: find the minimum value in input_array and subtract that\n", + " # value from all the elements of input_array. Store the\n", + " # result in inputs_minus_min\n", + " # We can use NumPy's min function and element-wise division\n", + " inputs_minus_min = input_array - np.min(input_array)\n", + "\n", + " # TODO: find the maximum value in inputs_minus_min and divide\n", + " # all of the values in inputs_minus_min by the maximum value.\n", + " # Store the results in inputs_div_max.\n", + " # We can use NumPy's max function and element-wise division\n", + " inputs_div_max = inputs_minus_min / np.max(inputs_minus_min)\n", + "\n", + " return input_array, inputs_minus_min, inputs_div_max\n", + " \n", + "\n", + "def multiply_inputs(m1, m2):\n", + " # Check the shapes of the matrices m1 and m2. \n", + " # m1 and m2 will be ndarray objects.\n", + " #\n", + " # Return False if the shapes cannot be used for matrix\n", + " # multiplication. You may not use a transpose\n", + " if m1.shape[0] != m2.shape[1] and m1.shape[1] != m2.shape[0]: \n", + " return False\n", + "\n", + " # Have not returned False, so calculate the matrix product\n", + " # of m1 and m2 and return it. Do not use a transpose,\n", + " # but you swap their order if necessary\n", + " if m1.shape[1] == m2.shape[0]:\n", + " return np.matmul(m1, m2) \n", + " else:\n", + " return np.matmul(m2, m1) \n", + "\n", + "\n", + "def find_mean(values):\n", + " # Return the average of the values in the given Python list\n", + " # NumPy has a lot of helpful methods like this.\n", + " return np.mean(values)\n" + ] + }, + { + "cell_type": "code", + "execution_count": 2, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Input as Array: [[-1 2 7]]\n", + "Input minus min: [[0 3 8]]\n", + "Input Array: [[0. 0.38 1. ]]\n", + "Multiply 1:\n", + "False\n", + "Multiply 2:\n", + "[[14]\n", + " [32]]\n", + "Multiply 3:\n", + "[[ 9 12 15]]\n", + "Mean == 2.6666666666666665\n" + ] + } + ], + "source": [ + "\n", + "input_array, inputs_minus_min, inputs_div_max = prepare_inputs([-1,2,7])\n", + "print(\"Input as Array: {}\".format(input_array))\n", + "print(\"Input minus min: {}\".format(inputs_minus_min))\n", + "print(\"Input Array: {}\".format(inputs_div_max))\n", + "\n", + "print(\"Multiply 1:\\n{}\".format(multiply_inputs(np.array([[1,2,3],[4,5,6]]), np.array([[1],[2],[3],[4]]))))\n", + "print(\"Multiply 2:\\n{}\".format(multiply_inputs(np.array([[1,2,3],[4,5,6]]), np.array([[1],[2],[3]]))))\n", + "print(\"Multiply 3:\\n{}\".format(multiply_inputs(np.array([[1,2,3],[4,5,6]]), np.array([[1,2]]))))\n", + "\n", + "print(\"Mean == {}\".format(find_mean([1,3,4])))" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Solution to Problem 2 - Body Mass Index" + ] + }, + { + "cell_type": "code", + "execution_count": 3, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "The given weights and lengths result in BMI's: \n", + "[19.59 22.22 20.94 24.93 31.38 19.74]\n" + ] + } + ], + "source": [ + "# import numpy\n", + "import numpy as np\n", + "np.set_printoptions(precision=2)\n", + "\n", + "def BMI(weight, length):\n", + " # Function returning the BMI of input vectors m and l\n", + " m = np.array(weight) # Create arrays from inputs\n", + " l = np.array(length)\n", + " \n", + " # Calculate all BMI's simultaniously\n", + " BMI = np.divide(m, l**2) \n", + " # Or just\n", + " BMI = m/l**2 \n", + " \n", + " return BMI\n", + "\n", + "m_example = [60, 72, 57, 90, 95, 72]\n", + "l_example = [1.75, 1.80, 1.65, 1.90, 1.74, 1.91]\n", + "print(\"The given weights and lengths result in BMI's: \\n{}\".format(BMI(m_example, l_example)))" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Solution to Problem 3 - Using Pandas: Weather" + ] + }, + { + "cell_type": "code", + "execution_count": 4, + "metadata": {}, + "outputs": [ + { + "data": { + "text/html": [ + "<div>\n", + "<style scoped>\n", + " .dataframe tbody tr th:only-of-type {\n", + " vertical-align: middle;\n", + " }\n", + "\n", + " .dataframe tbody tr th {\n", + " vertical-align: top;\n", + " }\n", + "\n", + " .dataframe thead th {\n", + " text-align: right;\n", + " }\n", + "</style>\n", + "<table border=\"1\" class=\"dataframe\">\n", + " <thead>\n", + " <tr style=\"text-align: right;\">\n", + " <th></th>\n", + " <th>Luzern</th>\n", + " <th>Basel</th>\n", + " <th>Chur</th>\n", + " <th>Zurich</th>\n", + " </tr>\n", + " </thead>\n", + " <tbody>\n", + " <tr>\n", + " <th>Jan</th>\n", + " <td>2</td>\n", + " <td>5</td>\n", + " <td>-3</td>\n", + " <td>4</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Feb</th>\n", + " <td>5</td>\n", + " <td>6</td>\n", + " <td>1</td>\n", + " <td>0</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Mar</th>\n", + " <td>10</td>\n", + " <td>11</td>\n", + " <td>13</td>\n", + " <td>8</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Apr</th>\n", + " <td>16</td>\n", + " <td>12</td>\n", + " <td>14</td>\n", + " <td>17</td>\n", + " </tr>\n", + " <tr>\n", + " <th>May</th>\n", + " <td>21</td>\n", + " <td>23</td>\n", + " <td>21</td>\n", + " <td>20</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Jun</th>\n", + " <td>25</td>\n", + " <td>21</td>\n", + " <td>23</td>\n", + " <td>27</td>\n", + " </tr>\n", + " </tbody>\n", + "</table>\n", + "</div>" + ], + "text/plain": [ + " Luzern Basel Chur Zurich\n", + "Jan 2 5 -3 4\n", + "Feb 5 6 1 0\n", + "Mar 10 11 13 8\n", + "Apr 16 12 14 17\n", + "May 21 23 21 20\n", + "Jun 25 21 23 27" + ] + }, + "execution_count": 4, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "# First import Pandas\n", + "import pandas as pd\n", + "\n", + "# load the database using pandas.read_csv \n", + "data = pd.read_csv(\"./Daten_Serie_1/weather.csv\")\n", + "data" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Viewing Data using Indices:\n" + ] + }, + { + "cell_type": "code", + "execution_count": 5, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Temperature in Basel is:\n", + " Jan 5\n", + "Feb 6\n", + "Mar 11\n", + "Apr 12\n", + "May 23\n", + "Jun 21\n", + "Name: Basel, dtype: int64 \n", + "\n", + "Temperature in Chur in February is:\n", + " 1\n" + ] + } + ], + "source": [ + "t_basel = data[\"Basel\"]\n", + "t_chur_feb = data.loc[\"Feb\", \"Chur\"]\n", + "\n", + "print(\"Temperature in Basel is:\\n\", t_basel, \"\\n\")\n", + "print(\"Temperature in Chur in February is:\\n\", t_chur_feb)" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Changing Indices" + ] + }, + { + "cell_type": "code", + "execution_count": 6, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Zurich\n" + ] + }, + { + "data": { + "text/html": [ + "<div>\n", + "<style scoped>\n", + " .dataframe tbody tr th:only-of-type {\n", + " vertical-align: middle;\n", + " }\n", + "\n", + " .dataframe tbody tr th {\n", + " vertical-align: top;\n", + " }\n", + "\n", + " .dataframe thead th {\n", + " text-align: right;\n", + " }\n", + "</style>\n", + "<table border=\"1\" class=\"dataframe\">\n", + " <thead>\n", + " <tr style=\"text-align: right;\">\n", + " <th></th>\n", + " <th>Luzern</th>\n", + " <th>Bern</th>\n", + " <th>Chur</th>\n", + " <th>Zurich</th>\n", + " </tr>\n", + " </thead>\n", + " <tbody>\n", + " <tr>\n", + " <th>Jan</th>\n", + " <td>2</td>\n", + " <td>5</td>\n", + " <td>-3</td>\n", + " <td>4</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Feb</th>\n", + " <td>5</td>\n", + " <td>6</td>\n", + " <td>1</td>\n", + " <td>0</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Mar</th>\n", + " <td>10</td>\n", + " <td>11</td>\n", + " <td>13</td>\n", + " <td>8</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Apr</th>\n", + " <td>16</td>\n", + " <td>12</td>\n", + " <td>14</td>\n", + " <td>17</td>\n", + " </tr>\n", + " <tr>\n", + " <th>May</th>\n", + " <td>21</td>\n", + " <td>23</td>\n", + " <td>21</td>\n", + " <td>20</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Jun</th>\n", + " <td>25</td>\n", + " <td>21</td>\n", + " <td>23</td>\n", + " <td>27</td>\n", + " </tr>\n", + " </tbody>\n", + "</table>\n", + "</div>" + ], + "text/plain": [ + " Luzern Bern Chur Zurich\n", + "Jan 2 5 -3 4\n", + "Feb 5 6 1 0\n", + "Mar 10 11 13 8\n", + "Apr 16 12 14 17\n", + "May 21 23 21 20\n", + "Jun 25 21 23 27" + ] + }, + "execution_count": 6, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "# Find the name of column 3:\n", + "all_columns = data.columns\n", + "name_c3 = all_columns[3]\n", + "# Oder \n", + "name_c3 = data.columns.values[3]\n", + "print(name_c3)\n", + " \n", + "# Change \"Basel\" to \"Bern\"\n", + "data.columns.values[1] = \"Bern\"\n", + "data" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### .mean() Method:\n", + "Now find :\n", + "- the average temperature in Chur (for the given Period)\n", + "- the average temperature in Spring in Switzerland (spring is Mar, Apr, May, mean of all cities)" + ] + }, + { + "cell_type": "code", + "execution_count": 7, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Average temperature in Chur was: 11.5\n", + "Average temperature in Spring was: 15.5\n" + ] + } + ], + "source": [ + "t_chur_mean = data.loc[:, \"Chur\"].mean()\n", + "t_spring_mean = data.loc[\"Mar\":\"May\", :].mean().mean()\n", + "# Hint: mean() on a DataFrame gives the result in a Serries. The axis of the function to be applied on can be set with axis={index (0), columns (1)}.\n", + "# To find the mean of the whole matrix, the mean method can be applied twice\n", + "\n", + "\n", + "print(\"Average temperature in Chur was: {}\".format(t_chur_mean))\n", + "print(\"Average temperature in Spring was: {}\".format(round(t_spring_mean, 1)))" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### .sort_values() Method:\n", + "- Sort the data based on the temperature in Zürich\n", + "- Sort the data based on decreasing temperature in Basel" + ] + }, + { + "cell_type": "code", + "execution_count": 8, + "metadata": {}, + "outputs": [ + { + "data": { + "text/html": [ + "<div>\n", + "<style scoped>\n", + " .dataframe tbody tr th:only-of-type {\n", + " vertical-align: middle;\n", + " }\n", + "\n", + " .dataframe tbody tr th {\n", + " vertical-align: top;\n", + " }\n", + "\n", + " .dataframe thead th {\n", + " text-align: right;\n", + " }\n", + "</style>\n", + "<table border=\"1\" class=\"dataframe\">\n", + " <thead>\n", + " <tr style=\"text-align: right;\">\n", + " <th></th>\n", + " <th>Luzern</th>\n", + " <th>Bern</th>\n", + " <th>Chur</th>\n", + " <th>Zurich</th>\n", + " </tr>\n", + " </thead>\n", + " <tbody>\n", + " <tr>\n", + " <th>Feb</th>\n", + " <td>5</td>\n", + " <td>6</td>\n", + " <td>1</td>\n", + " <td>0</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Jan</th>\n", + " <td>2</td>\n", + " <td>5</td>\n", + " <td>-3</td>\n", + " <td>4</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Mar</th>\n", + " <td>10</td>\n", + " <td>11</td>\n", + " <td>13</td>\n", + " <td>8</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Apr</th>\n", + " <td>16</td>\n", + " <td>12</td>\n", + " <td>14</td>\n", + " <td>17</td>\n", + " </tr>\n", + " <tr>\n", + " <th>May</th>\n", + " <td>21</td>\n", + " <td>23</td>\n", + " <td>21</td>\n", + " <td>20</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Jun</th>\n", + " <td>25</td>\n", + " <td>21</td>\n", + " <td>23</td>\n", + " <td>27</td>\n", + " </tr>\n", + " </tbody>\n", + "</table>\n", + "</div>" + ], + "text/plain": [ + " Luzern Bern Chur Zurich\n", + "Feb 5 6 1 0\n", + "Jan 2 5 -3 4\n", + "Mar 10 11 13 8\n", + "Apr 16 12 14 17\n", + "May 21 23 21 20\n", + "Jun 25 21 23 27" + ] + }, + "execution_count": 8, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "data.sort_values(\"Zurich\")" + ] + }, + { + "cell_type": "code", + "execution_count": 9, + "metadata": {}, + "outputs": [ + { + "data": { + "text/html": [ + "<div>\n", + "<style scoped>\n", + " .dataframe tbody tr th:only-of-type {\n", + " vertical-align: middle;\n", + " }\n", + "\n", + " .dataframe tbody tr th {\n", + " vertical-align: top;\n", + " }\n", + "\n", + " .dataframe thead th {\n", + " text-align: right;\n", + " }\n", + "</style>\n", + "<table border=\"1\" class=\"dataframe\">\n", + " <thead>\n", + " <tr style=\"text-align: right;\">\n", + " <th></th>\n", + " <th>Luzern</th>\n", + " <th>Bern</th>\n", + " <th>Chur</th>\n", + " <th>Zurich</th>\n", + " </tr>\n", + " </thead>\n", + " <tbody>\n", + " <tr>\n", + " <th>May</th>\n", + " <td>21</td>\n", + " <td>23</td>\n", + " <td>21</td>\n", + " <td>20</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Jun</th>\n", + " <td>25</td>\n", + " <td>21</td>\n", + " <td>23</td>\n", + " <td>27</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Apr</th>\n", + " <td>16</td>\n", + " <td>12</td>\n", + " <td>14</td>\n", + " <td>17</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Mar</th>\n", + " <td>10</td>\n", + " <td>11</td>\n", + " <td>13</td>\n", + " <td>8</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Feb</th>\n", + " <td>5</td>\n", + " <td>6</td>\n", + " <td>1</td>\n", + " <td>0</td>\n", + " </tr>\n", + " <tr>\n", + " <th>Jan</th>\n", + " <td>2</td>\n", + " <td>5</td>\n", + " <td>-3</td>\n", + " <td>4</td>\n", + " </tr>\n", + " </tbody>\n", + "</table>\n", + "</div>" + ], + "text/plain": [ + " Luzern Bern Chur Zurich\n", + "May 21 23 21 20\n", + "Jun 25 21 23 27\n", + "Apr 16 12 14 17\n", + "Mar 10 11 13 8\n", + "Feb 5 6 1 0\n", + "Jan 2 5 -3 4" + ] + }, + "execution_count": 9, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "data.sort_values(\"Basel\", ascending=False)" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Solution to Problem 4: Fuel Consumption" + ] + }, + { + "cell_type": "code", + "execution_count": 10, + "metadata": {}, + "outputs": [ + { + "data": { + "text/html": [ + "<div>\n", + "<style scoped>\n", + " .dataframe tbody tr th:only-of-type {\n", + " vertical-align: middle;\n", + " }\n", + "\n", + " .dataframe tbody tr th {\n", + " vertical-align: top;\n", + " }\n", + "\n", + " .dataframe thead th {\n", + " text-align: right;\n", + " }\n", + "</style>\n", + "<table border=\"1\" class=\"dataframe\">\n", + " <thead>\n", + " <tr style=\"text-align: right;\">\n", + " <th></th>\n", + " <th>X</th>\n", + " <th>weight</th>\n", + " <th>mpg</th>\n", + " <th>type</th>\n", + " </tr>\n", + " </thead>\n", + " <tbody>\n", + " <tr>\n", + " <th>0</th>\n", + " <td>1</td>\n", + " <td>2560</td>\n", + " <td>33</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>1</th>\n", + " <td>2</td>\n", + " <td>2345</td>\n", + " <td>33</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>2</th>\n", + " <td>3</td>\n", + " <td>1845</td>\n", + " <td>37</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>3</th>\n", + " <td>4</td>\n", + " <td>2260</td>\n", + " <td>32</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>4</th>\n", + " <td>5</td>\n", + " <td>2440</td>\n", + " <td>32</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>5</th>\n", + " <td>6</td>\n", + " <td>2285</td>\n", + " <td>26</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>6</th>\n", + " <td>7</td>\n", + " <td>2275</td>\n", + " <td>33</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>7</th>\n", + " <td>8</td>\n", + " <td>2350</td>\n", + " <td>28</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>8</th>\n", + " <td>9</td>\n", + " <td>2295</td>\n", + " <td>25</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>9</th>\n", + " <td>10</td>\n", + " <td>1900</td>\n", + " <td>34</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>10</th>\n", + " <td>11</td>\n", + " <td>2390</td>\n", + " <td>29</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>11</th>\n", + " <td>12</td>\n", + " <td>2075</td>\n", + " <td>35</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>12</th>\n", + " <td>13</td>\n", + " <td>2330</td>\n", + " <td>26</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>13</th>\n", + " <td>14</td>\n", + " <td>3320</td>\n", + " <td>20</td>\n", + " <td>Sporty</td>\n", + " </tr>\n", + " <tr>\n", + " <th>14</th>\n", + " <td>15</td>\n", + " <td>2885</td>\n", + " <td>27</td>\n", + " <td>Sporty</td>\n", + " </tr>\n", + " <tr>\n", + " <th>15</th>\n", + " <td>16</td>\n", + " <td>3310</td>\n", + " <td>19</td>\n", + " <td>Sporty</td>\n", + " </tr>\n", + " <tr>\n", + " <th>16</th>\n", + " <td>17</td>\n", + " <td>2695</td>\n", + " <td>30</td>\n", + " <td>Sporty</td>\n", + " </tr>\n", + " <tr>\n", + " <th>17</th>\n", + " <td>18</td>\n", + " <td>2170</td>\n", + " <td>33</td>\n", + " <td>Sporty</td>\n", + " </tr>\n", + " <tr>\n", + " <th>18</th>\n", + " <td>19</td>\n", + " <td>2710</td>\n", + " <td>27</td>\n", + " <td>Sporty</td>\n", + " </tr>\n", + " <tr>\n", + " <th>19</th>\n", + " <td>20</td>\n", + " <td>2775</td>\n", + " <td>24</td>\n", + " <td>Sporty</td>\n", + " </tr>\n", + " <tr>\n", + " <th>20</th>\n", + " <td>21</td>\n", + " <td>2840</td>\n", + " <td>26</td>\n", + " <td>Sporty</td>\n", + " </tr>\n", + " <tr>\n", + " <th>21</th>\n", + " <td>22</td>\n", + " <td>2485</td>\n", + " <td>28</td>\n", + " <td>Sporty</td>\n", + " </tr>\n", + " <tr>\n", + " <th>22</th>\n", + " <td>23</td>\n", + " <td>2670</td>\n", + " <td>27</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>23</th>\n", + " <td>24</td>\n", + " <td>2640</td>\n", + " <td>23</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>24</th>\n", + " <td>25</td>\n", + " <td>2655</td>\n", + " <td>26</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>25</th>\n", + " <td>26</td>\n", + " <td>3065</td>\n", + " <td>25</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>26</th>\n", + " <td>27</td>\n", + " <td>2750</td>\n", + " <td>24</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>27</th>\n", + " <td>28</td>\n", + " <td>2920</td>\n", + " <td>26</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>28</th>\n", + " <td>29</td>\n", + " <td>2780</td>\n", + " <td>24</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>29</th>\n", + " <td>30</td>\n", + " <td>2745</td>\n", + " <td>25</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>30</th>\n", + " <td>31</td>\n", + " <td>3110</td>\n", + " <td>21</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>31</th>\n", + " <td>32</td>\n", + " <td>2920</td>\n", + " <td>21</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>32</th>\n", + " <td>33</td>\n", + " <td>2645</td>\n", + " <td>23</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>33</th>\n", + " <td>34</td>\n", + " <td>2575</td>\n", + " <td>24</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>34</th>\n", + " <td>35</td>\n", + " <td>2935</td>\n", + " <td>23</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>35</th>\n", + " <td>36</td>\n", + " <td>2920</td>\n", + " <td>27</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>36</th>\n", + " <td>37</td>\n", + " <td>2985</td>\n", + " <td>23</td>\n", + " <td>Compact</td>\n", + " </tr>\n", + " <tr>\n", + " <th>37</th>\n", + " <td>38</td>\n", + " <td>3265</td>\n", + " <td>20</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>38</th>\n", + " <td>39</td>\n", + " <td>2880</td>\n", + " <td>21</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>39</th>\n", + " <td>40</td>\n", + " <td>2975</td>\n", + " <td>22</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>40</th>\n", + " <td>41</td>\n", + " <td>3450</td>\n", + " <td>22</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>41</th>\n", + " <td>42</td>\n", + " <td>3145</td>\n", + " <td>22</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>42</th>\n", + " <td>43</td>\n", + " <td>3190</td>\n", + " <td>22</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>43</th>\n", + " <td>44</td>\n", + " <td>3610</td>\n", + " <td>23</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>44</th>\n", + " <td>45</td>\n", + " <td>2885</td>\n", + " <td>23</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>45</th>\n", + " <td>46</td>\n", + " <td>3480</td>\n", + " <td>21</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>46</th>\n", + " <td>47</td>\n", + " <td>3200</td>\n", + " <td>22</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>47</th>\n", + " <td>48</td>\n", + " <td>2765</td>\n", + " <td>21</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>48</th>\n", + " <td>49</td>\n", + " <td>3220</td>\n", + " <td>21</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>49</th>\n", + " <td>50</td>\n", + " <td>3480</td>\n", + " <td>23</td>\n", + " <td>Medium</td>\n", + " </tr>\n", + " <tr>\n", + " <th>50</th>\n", + " <td>51</td>\n", + " <td>3325</td>\n", + " <td>23</td>\n", + " <td>Large</td>\n", + " </tr>\n", + " <tr>\n", + " <th>51</th>\n", + " <td>52</td>\n", + " <td>3855</td>\n", + " <td>18</td>\n", + " <td>Large</td>\n", + " </tr>\n", + " <tr>\n", + " <th>52</th>\n", + " <td>53</td>\n", + " <td>3850</td>\n", + " <td>20</td>\n", + " <td>Large</td>\n", + " </tr>\n", + " <tr>\n", + " <th>53</th>\n", + " <td>54</td>\n", + " <td>3195</td>\n", + " <td>18</td>\n", + " <td>Van</td>\n", + " </tr>\n", + " <tr>\n", + " <th>54</th>\n", + " <td>55</td>\n", + " <td>3735</td>\n", + " <td>18</td>\n", + " <td>Van</td>\n", + " </tr>\n", + " <tr>\n", + " <th>55</th>\n", + " <td>56</td>\n", + " <td>3665</td>\n", + " <td>18</td>\n", + " <td>Van</td>\n", + " </tr>\n", + " <tr>\n", + " <th>56</th>\n", + " <td>57</td>\n", + " <td>3735</td>\n", + " <td>19</td>\n", + " <td>Van</td>\n", + " </tr>\n", + " <tr>\n", + " <th>57</th>\n", + " <td>58</td>\n", + " <td>3415</td>\n", + " <td>20</td>\n", + " <td>Van</td>\n", + " </tr>\n", + " <tr>\n", + " <th>58</th>\n", + " <td>59</td>\n", + " <td>3185</td>\n", + " <td>20</td>\n", + " <td>Van</td>\n", + " </tr>\n", + " <tr>\n", + " <th>59</th>\n", + " <td>60</td>\n", + " <td>3690</td>\n", + " <td>19</td>\n", + " <td>Van</td>\n", + " </tr>\n", + " </tbody>\n", + "</table>\n", + "</div>" + ], + "text/plain": [ + " X weight mpg type\n", + "0 1 2560 33 Small\n", + "1 2 2345 33 Small\n", + "2 3 1845 37 Small\n", + "3 4 2260 32 Small\n", + "4 5 2440 32 Small\n", + "5 6 2285 26 Small\n", + "6 7 2275 33 Small\n", + "7 8 2350 28 Small\n", + "8 9 2295 25 Small\n", + "9 10 1900 34 Small\n", + "10 11 2390 29 Small\n", + "11 12 2075 35 Small\n", + "12 13 2330 26 Small\n", + "13 14 3320 20 Sporty\n", + "14 15 2885 27 Sporty\n", + "15 16 3310 19 Sporty\n", + "16 17 2695 30 Sporty\n", + "17 18 2170 33 Sporty\n", + "18 19 2710 27 Sporty\n", + "19 20 2775 24 Sporty\n", + "20 21 2840 26 Sporty\n", + "21 22 2485 28 Sporty\n", + "22 23 2670 27 Compact\n", + "23 24 2640 23 Compact\n", + "24 25 2655 26 Compact\n", + "25 26 3065 25 Compact\n", + "26 27 2750 24 Compact\n", + "27 28 2920 26 Compact\n", + "28 29 2780 24 Compact\n", + "29 30 2745 25 Compact\n", + "30 31 3110 21 Compact\n", + "31 32 2920 21 Compact\n", + "32 33 2645 23 Compact\n", + "33 34 2575 24 Compact\n", + "34 35 2935 23 Compact\n", + "35 36 2920 27 Compact\n", + "36 37 2985 23 Compact\n", + "37 38 3265 20 Medium\n", + "38 39 2880 21 Medium\n", + "39 40 2975 22 Medium\n", + "40 41 3450 22 Medium\n", + "41 42 3145 22 Medium\n", + "42 43 3190 22 Medium\n", + "43 44 3610 23 Medium\n", + "44 45 2885 23 Medium\n", + "45 46 3480 21 Medium\n", + "46 47 3200 22 Medium\n", + "47 48 2765 21 Medium\n", + "48 49 3220 21 Medium\n", + "49 50 3480 23 Medium\n", + "50 51 3325 23 Large\n", + "51 52 3855 18 Large\n", + "52 53 3850 20 Large\n", + "53 54 3195 18 Van\n", + "54 55 3735 18 Van\n", + "55 56 3665 18 Van\n", + "56 57 3735 19 Van\n", + "57 58 3415 20 Van\n", + "58 59 3185 20 Van\n", + "59 60 3690 19 Van" + ] + }, + "execution_count": 10, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "# First import Pandas\n", + "import pandas as pd\n", + "\n", + "# load the database using pandas.read_csv with options: sep=\",\" and index_col=0\n", + "# data = None\n", + "data = pd.read_csv(\"./Daten_Serie_1/d.fuel.dat\")\n", + "\n", + "data" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + " To get a quick overview, we can view only the first 5 rows of the dataset. Print the first five rows using:\n", + " - **dataframe.loc**\n", + " - **DataFrame.head()** " + ] + }, + { + "cell_type": "code", + "execution_count": 11, + "metadata": {}, + "outputs": [ + { + "data": { + "text/html": [ + "<div>\n", + "<style scoped>\n", + " .dataframe tbody tr th:only-of-type {\n", + " vertical-align: middle;\n", + " }\n", + "\n", + " .dataframe tbody tr th {\n", + " vertical-align: top;\n", + " }\n", + "\n", + " .dataframe thead th {\n", + " text-align: right;\n", + " }\n", + "</style>\n", + "<table border=\"1\" class=\"dataframe\">\n", + " <thead>\n", + " <tr style=\"text-align: right;\">\n", + " <th></th>\n", + " <th>X</th>\n", + " <th>weight</th>\n", + " <th>mpg</th>\n", + " <th>type</th>\n", + " </tr>\n", + " </thead>\n", + " <tbody>\n", + " <tr>\n", + " <th>1</th>\n", + " <td>2</td>\n", + " <td>2345</td>\n", + " <td>33</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>2</th>\n", + " <td>3</td>\n", + " <td>1845</td>\n", + " <td>37</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>3</th>\n", + " <td>4</td>\n", + " <td>2260</td>\n", + " <td>32</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>4</th>\n", + " <td>5</td>\n", + " <td>2440</td>\n", + " <td>32</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>5</th>\n", + " <td>6</td>\n", + " <td>2285</td>\n", + " <td>26</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " </tbody>\n", + "</table>\n", + "</div>" + ], + "text/plain": [ + " X weight mpg type\n", + "1 2 2345 33 Small\n", + "2 3 1845 37 Small\n", + "3 4 2260 32 Small\n", + "4 5 2440 32 Small\n", + "5 6 2285 26 Small" + ] + }, + "execution_count": 11, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "# Print the first 5 rows using data.loc\n", + "data.loc[1:5,:]" + ] + }, + { + "cell_type": "code", + "execution_count": 12, + "metadata": {}, + "outputs": [ + { + "data": { + "text/html": [ + "<div>\n", + "<style scoped>\n", + " .dataframe tbody tr th:only-of-type {\n", + " vertical-align: middle;\n", + " }\n", + "\n", + " .dataframe tbody tr th {\n", + " vertical-align: top;\n", + " }\n", + "\n", + " .dataframe thead th {\n", + " text-align: right;\n", + " }\n", + "</style>\n", + "<table border=\"1\" class=\"dataframe\">\n", + " <thead>\n", + " <tr style=\"text-align: right;\">\n", + " <th></th>\n", + " <th>X</th>\n", + " <th>weight</th>\n", + " <th>mpg</th>\n", + " <th>type</th>\n", + " </tr>\n", + " </thead>\n", + " <tbody>\n", + " <tr>\n", + " <th>0</th>\n", + " <td>1</td>\n", + " <td>2560</td>\n", + " <td>33</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>1</th>\n", + " <td>2</td>\n", + " <td>2345</td>\n", + " <td>33</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>2</th>\n", + " <td>3</td>\n", + " <td>1845</td>\n", + " <td>37</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>3</th>\n", + " <td>4</td>\n", + " <td>2260</td>\n", + " <td>32</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " <tr>\n", + " <th>4</th>\n", + " <td>5</td>\n", + " <td>2440</td>\n", + " <td>32</td>\n", + " <td>Small</td>\n", + " </tr>\n", + " </tbody>\n", + "</table>\n", + "</div>" + ], + "text/plain": [ + " X weight mpg type\n", + "0 1 2560 33 Small\n", + "1 2 2345 33 Small\n", + "2 3 1845 37 Small\n", + "3 4 2260 32 Small\n", + "4 5 2440 32 Small" + ] + }, + "execution_count": 12, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "# print the first 5 rows using data.head()\n", + "data.head()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### .mean() Method:\n", + "Now find :\n", + "- the average range of all cars\n", + "- the average range of all cars with type \"Medium\" (hint, select all rows with a certain constraint using **DataFrame[DataFrame[** *column* **].isin([** *values* **])]**\n" + ] + }, + { + "cell_type": "code", + "execution_count": 13, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Average miles per galon is: \n", + "24.58 \n", + "Average miles per galon for all Medium type cars is: \n", + "21.77\n" + ] + } + ], + "source": [ + "data.mean() # Gives all averages\n", + "avg_mpg = data.mean()[\"mpg\"] # Gives the average mpg\n", + "\n", + "avg_medium = data[data[\"type\"].isin([\"Medium\"])].mean()[\"mpg\"]\n", + "\n", + "print(\"Average miles per galon is: \\n{}\".format(round(avg_mpg, 2)), \"\\nAverage miles per galon for all Medium type cars is: \\n{}\".format(round(avg_medium,2)))" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Conversion to SI units\n", + "- Create a Series containing the range in km/l and another Series containing the weight in kg.\n", + "- Find the average of these new Vectors\n" + ] + }, + { + "cell_type": "code", + "execution_count": 14, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "0 14.018470\n", + "1 14.018470\n", + "2 15.717678\n", + "3 13.593668\n", + "4 13.593668\n", + "Name: mpg, dtype: float64\n", + "0 1162.24\n", + "1 1064.63\n", + "2 837.63\n", + "3 1026.04\n", + "4 1107.76\n", + "Name: weight, dtype: float64\n", + "\n", + "Average Kilometer per liter is: \n", + "10.44 \n", + "Average weight in kilogram is: \n", + "1316.98\n" + ] + } + ], + "source": [ + "t_kml = data[\"mpg\"]*1.61/3.79\n", + "t_kg = data[\"weight\"]*0.454\n", + "\n", + "print(t_kml.head())\n", + "print(t_kg.head())\n", + "\n", + "avg_kml = t_kml.mean()\n", + "avg_kg = t_kg.mean()\n", + "print(\"\\nAverage Kilometer per liter is: \\n{}\".format(round(avg_kml, 2)), \"\\nAverage weight in kilogram is: \\n{}\".format(round(avg_kg,2)))" + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python [conda env:root]", + "language": "python", + "name": "conda-root-py" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.8.3" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/requirements.txt b/requirements.txt index e69de29..30d6343 100644 --- a/requirements.txt +++ b/requirements.txt @@ -0,0 +1,5 @@ +numpy==1.19.1 +pandas==1.1.3 +matplotlib==3.3.1 +opencv-python==4.1.2.30 +tensorflow==2.1.0 \ No newline at end of file -- GitLab